C26H45IO3 — CID 151133876
1-(1-iodoethyl)-4-[3-(triethoxymethyl)undecyl]benzene (PubChem CID 151133876) has the molecular formula C26H45IO3 and a molecular weight of 532.55 g/mol. Its IUPAC name is 1-(1-iodoethyl)-4-[3-(triethoxymethyl)undecyl]benzene.
| Compound Name | 1-(1-iodoethyl)-4-[3-(triethoxymethyl)undecyl]benzene |
|---|---|
| PubChem CID | 151133876 |
| Molecular Formula | C26H45IO3 |
| Molecular Weight | 532.55 g/mol |
| Exact Mass | 532.24 |
| IUPAC Name | 1-(1-iodoethyl)-4-[3-(triethoxymethyl)undecyl]benzene |
| SMILES | CCCCCCCCC(CCc1ccc(C(C)I)cc1)C(OCC)(OCC)OCC |
| InChI | InChI=1S/C26H45IO3/c1-6-10-11-12-13-14-15-25(26(28-7-2,29-8-3)30-9-4)21-18-23-16-19-24(20-17-23)22(5)27/h16-17,19-20,22,25H,6-15,18,21H2,1-5H3 |
| InChIKey | MUUKZJPGGDGKNY-UHFFFAOYSA-N |
| XLogP | 8.25 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.55 |
| LogP ≤ 5 | 8.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|