C14H20FO3Si — CID 90174712
CID 90174712 (PubChem CID 90174712) has the molecular formula C14H20FO3Si and a molecular weight of 283.39 g/mol.
| Compound Name | CID 90174712 |
|---|---|
| PubChem CID | 90174712 |
| Molecular Formula | C14H20FO3Si |
| Molecular Weight | 283.39 g/mol |
| Exact Mass | 283.12 |
| IUPAC Name | — |
| SMILES | CCOC(CCCc1cccc(F)c1)(O[Si])OCC |
| InChI | InChI=1S/C14H20FO3Si/c1-3-16-14(18-19,17-4-2)10-6-8-12-7-5-9-13(15)11-12/h5,7,9,11H,3-4,6,8,10H2,1-2H3 |
| InChIKey | DAFFLRIECLUUHW-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.39 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|