C13H16F2O — CID 64561193
1-(2,4-difluorophenyl)hept-6-en-2-ol (PubChem CID 64561193) has the molecular formula C13H16F2O and a molecular weight of 226.27 g/mol. Its IUPAC name is 1-(2,4-difluorophenyl)hept-6-en-2-ol.
| Compound Name | 1-(2,4-difluorophenyl)hept-6-en-2-ol |
|---|---|
| PubChem CID | 64561193 |
| Molecular Formula | C13H16F2O |
| Molecular Weight | 226.27 g/mol |
| Exact Mass | 226.12 |
| IUPAC Name | 1-(2,4-difluorophenyl)hept-6-en-2-ol |
| SMILES | C=CCCCC(O)Cc1ccc(F)cc1F |
| InChI | InChI=1S/C13H16F2O/c1-2-3-4-5-12(16)8-10-6-7-11(14)9-13(10)15/h2,6-7,9,12,16H,1,3-5,8H2 |
| InChIKey | WWKZOLGZPXGGHQ-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.27 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|