C18H19F2NO2 — CID 110024335
N-[1-(2,4-difluorophenyl)ethyl]-3-hydroxy-3-phenylbutanamide (PubChem CID 110024335) has the molecular formula C18H19F2NO2 and a molecular weight of 319.35 g/mol. Its IUPAC name is N-[1-(2,4-difluorophenyl)ethyl]-3-hydroxy-3-phenylbutanamide.
| Compound Name | N-[1-(2,4-difluorophenyl)ethyl]-3-hydroxy-3-phenylbutanamide |
|---|---|
| PubChem CID | 110024335 |
| Molecular Formula | C18H19F2NO2 |
| Molecular Weight | 319.35 g/mol |
| Exact Mass | 319.14 |
| IUPAC Name | N-[1-(2,4-difluorophenyl)ethyl]-3-hydroxy-3-phenylbutanamide |
| SMILES | CC(NC(=O)CC(C)(O)c1ccccc1)c1ccc(F)cc1F |
| InChI | InChI=1S/C18H19F2NO2/c1-12(15-9-8-14(19)10-16(15)20)21-17(22)11-18(2,23)13-6-4-3-5-7-13/h3-10,12,23H,11H2,1-2H3,(H,21,22) |
| InChIKey | FLZUWKLBEQBSGR-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.35 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |