C18H20F2N2O2 — CID 111335690
1-[1-(2,4-difluorophenyl)ethyl]-3-(2-hydroxy-2-phenylpropyl)urea (PubChem CID 111335690) has the molecular formula C18H20F2N2O2 and a molecular weight of 334.37 g/mol. Its IUPAC name is 1-[1-(2,4-difluorophenyl)ethyl]-3-(2-hydroxy-2-phenylpropyl)urea.
| Compound Name | 1-[1-(2,4-difluorophenyl)ethyl]-3-(2-hydroxy-2-phenylpropyl)urea |
|---|---|
| PubChem CID | 111335690 |
| Molecular Formula | C18H20F2N2O2 |
| Molecular Weight | 334.37 g/mol |
| Exact Mass | 334.15 |
| IUPAC Name | 1-[1-(2,4-difluorophenyl)ethyl]-3-(2-hydroxy-2-phenylpropyl)urea |
| SMILES | CC(NC(=O)NCC(C)(O)c1ccccc1)c1ccc(F)cc1F |
| InChI | InChI=1S/C18H20F2N2O2/c1-12(15-9-8-14(19)10-16(15)20)22-17(23)21-11-18(2,24)13-6-4-3-5-7-13/h3-10,12,24H,11H2,1-2H3,(H2,21,22,23) |
| InChIKey | GVSRDFDCOAAUGP-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.37 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |