C16H19FN2O3 — CID 97245826
1-[(2R)-2-(4-fluorophenyl)-2-hydroxypropyl]-3-[(1R)-1-(furan-2-yl)ethyl]urea (PubChem CID 97245826) has the molecular formula C16H19FN2O3 and a molecular weight of 306.34 g/mol. Its IUPAC name is 1-[(2R)-2-(4-fluorophenyl)-2-hydroxypropyl]-3-[(1R)-1-(furan-2-yl)ethyl]urea.
| Compound Name | 1-[(2R)-2-(4-fluorophenyl)-2-hydroxypropyl]-3-[(1R)-1-(furan-2-yl)ethyl]urea |
|---|---|
| PubChem CID | 97245826 |
| Molecular Formula | C16H19FN2O3 |
| Molecular Weight | 306.34 g/mol |
| Exact Mass | 306.14 |
| IUPAC Name | 1-[(2R)-2-(4-fluorophenyl)-2-hydroxypropyl]-3-[(1R)-1-(furan-2-yl)ethyl]urea |
| SMILES | C[C@@H](NC(=O)NC[C@](C)(O)c1ccc(F)cc1)c1ccco1 |
| InChI | InChI=1S/C16H19FN2O3/c1-11(14-4-3-9-22-14)19-15(20)18-10-16(2,21)12-5-7-13(17)8-6-12/h3-9,11,21H,10H2,1-2H3,(H2,18,19,20)/t11-,16+/m1/s1 |
| InChIKey | MRAXMHMTVDXJHS-BZNIZROVSA-N |
| XLogP | 2.69 |
| TPSA | 74.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.34 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |