C20H21F2NO4 — CID 120529005
2-[4-[2-[3-(2,4-difluorophenyl)butanoylamino]ethyl]phenoxy]acetic acid (PubChem CID 120529005) has the molecular formula C20H21F2NO4 and a molecular weight of 377.39 g/mol. Its IUPAC name is 2-[4-[2-[3-(2,4-difluorophenyl)butanoylamino]ethyl]phenoxy]acetic acid.
| Compound Name | 2-[4-[2-[3-(2,4-difluorophenyl)butanoylamino]ethyl]phenoxy]acetic acid |
|---|---|
| PubChem CID | 120529005 |
| Molecular Formula | C20H21F2NO4 |
| Molecular Weight | 377.39 g/mol |
| Exact Mass | 377.14 |
| IUPAC Name | 2-[4-[2-[3-(2,4-difluorophenyl)butanoylamino]ethyl]phenoxy]acetic acid |
| SMILES | CC(CC(=O)NCCc1ccc(OCC(=O)O)cc1)c1ccc(F)cc1F |
| InChI | InChI=1S/C20H21F2NO4/c1-13(17-7-4-15(21)11-18(17)22)10-19(24)23-9-8-14-2-5-16(6-3-14)27-12-20(25)26/h2-7,11,13H,8-10,12H2,1H3,(H,23,24)(H,25,26) |
| InChIKey | FWEUULYUXMAZAE-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.39 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |