C20H20F2N2O2 — CID 86875310
1-[1-(2,4-difluorophenyl)ethyl]-3-[2-(4-prop-2-ynoxyphenyl)ethyl]urea (PubChem CID 86875310) has the molecular formula C20H20F2N2O2 and a molecular weight of 358.39 g/mol. Its IUPAC name is 1-[1-(2,4-difluorophenyl)ethyl]-3-[2-(4-prop-2-ynoxyphenyl)ethyl]urea.
| Compound Name | 1-[1-(2,4-difluorophenyl)ethyl]-3-[2-(4-prop-2-ynoxyphenyl)ethyl]urea |
|---|---|
| PubChem CID | 86875310 |
| Molecular Formula | C20H20F2N2O2 |
| Molecular Weight | 358.39 g/mol |
| Exact Mass | 358.15 |
| IUPAC Name | 1-[1-(2,4-difluorophenyl)ethyl]-3-[2-(4-prop-2-ynoxyphenyl)ethyl]urea |
| SMILES | C#CCOc1ccc(CCNC(=O)NC(C)c2ccc(F)cc2F)cc1 |
| InChI | InChI=1S/C20H20F2N2O2/c1-3-12-26-17-7-4-15(5-8-17)10-11-23-20(25)24-14(2)18-9-6-16(21)13-19(18)22/h1,4-9,13-14H,10-12H2,2H3,(H2,23,24,25) |
| InChIKey | INDRHOKAIIBIAV-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.39 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|