C17H18BrFN2O — CID 41134387
1-[(1S)-1-(2-bromophenyl)ethyl]-3-[2-(4-fluorophenyl)ethyl]urea (PubChem CID 41134387) has the molecular formula C17H18BrFN2O and a molecular weight of 365.25 g/mol. Its IUPAC name is 1-[(1S)-1-(2-bromophenyl)ethyl]-3-[2-(4-fluorophenyl)ethyl]urea.
| Compound Name | 1-[(1S)-1-(2-bromophenyl)ethyl]-3-[2-(4-fluorophenyl)ethyl]urea |
|---|---|
| PubChem CID | 41134387 |
| Molecular Formula | C17H18BrFN2O |
| Molecular Weight | 365.25 g/mol |
| Exact Mass | 364.06 |
| IUPAC Name | 1-[(1S)-1-(2-bromophenyl)ethyl]-3-[2-(4-fluorophenyl)ethyl]urea |
| SMILES | C[C@H](NC(=O)NCCc1ccc(F)cc1)c1ccccc1Br |
| InChI | InChI=1S/C17H18BrFN2O/c1-12(15-4-2-3-5-16(15)18)21-17(22)20-11-10-13-6-8-14(19)9-7-13/h2-9,12H,10-11H2,1H3,(H2,20,21,22)/t12-/m0/s1 |
| InChIKey | ZLYAPUDERXKOES-LBPRGKRZSA-N |
| XLogP | 4.19 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.25 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |