C14H18FN2O3- — CID 2011301
(2S)-2-[2-(4-fluorophenyl)ethylcarbamoylamino]-3-methylbutanoate (PubChem CID 2011301) has the molecular formula C14H18FN2O3- and a molecular weight of 281.31 g/mol. Its IUPAC name is (2S)-2-[2-(4-fluorophenyl)ethylcarbamoylamino]-3-methylbutanoate.
| Compound Name | (2S)-2-[2-(4-fluorophenyl)ethylcarbamoylamino]-3-methylbutanoate |
|---|---|
| PubChem CID | 2011301 |
| Molecular Formula | C14H18FN2O3- |
| Molecular Weight | 281.31 g/mol |
| Exact Mass | 281.13 |
| IUPAC Name | (2S)-2-[2-(4-fluorophenyl)ethylcarbamoylamino]-3-methylbutanoate |
| SMILES | CC(C)[C@H](NC(=O)NCCc1ccc(F)cc1)C(=O)[O-] |
| InChI | InChI=1S/C14H19FN2O3/c1-9(2)12(13(18)19)17-14(20)16-8-7-10-3-5-11(15)6-4-10/h3-6,9,12H,7-8H2,1-2H3,(H,18,19)(H2,16,17,20)/p-1/t12-/m0/s1 |
| InChIKey | CZOLZEOQUQOUQY-LBPRGKRZSA-M |
| XLogP | 0.44 |
| TPSA | 81.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.31 |
| LogP ≤ 5 | 0.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |