C14H18F2N2O3 — CID 79009319
(2R)-2-[2-(3,5-difluorophenyl)ethylcarbamoylamino]-3-methylbutanoic acid (PubChem CID 79009319) has the molecular formula C14H18F2N2O3 and a molecular weight of 300.31 g/mol. Its IUPAC name is (2R)-2-[2-(3,5-difluorophenyl)ethylcarbamoylamino]-3-methylbutanoic acid.
| Compound Name | (2R)-2-[2-(3,5-difluorophenyl)ethylcarbamoylamino]-3-methylbutanoic acid |
|---|---|
| PubChem CID | 79009319 |
| Molecular Formula | C14H18F2N2O3 |
| Molecular Weight | 300.31 g/mol |
| Exact Mass | 300.13 |
| IUPAC Name | (2R)-2-[2-(3,5-difluorophenyl)ethylcarbamoylamino]-3-methylbutanoic acid |
| SMILES | CC(C)[C@@H](NC(=O)NCCc1cc(F)cc(F)c1)C(=O)O |
| InChI | InChI=1S/C14H18F2N2O3/c1-8(2)12(13(19)20)18-14(21)17-4-3-9-5-10(15)7-11(16)6-9/h5-8,12H,3-4H2,1-2H3,(H,19,20)(H2,17,18,21)/t12-/m1/s1 |
| InChIKey | MFKVCZYVJZWCKZ-GFCCVEGCSA-N |
| XLogP | 1.92 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.31 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |