C26H27N3O3 — CID 86875382
1-[2-(4-prop-2-ynoxyphenyl)ethyl]-3-[1-[4-(pyridin-3-ylmethoxy)phenyl]ethyl]urea (PubChem CID 86875382) has the molecular formula C26H27N3O3 and a molecular weight of 429.52 g/mol. Its IUPAC name is 1-[2-(4-prop-2-ynoxyphenyl)ethyl]-3-[1-[4-(pyridin-3-ylmethoxy)phenyl]ethyl]urea.
| Compound Name | 1-[2-(4-prop-2-ynoxyphenyl)ethyl]-3-[1-[4-(pyridin-3-ylmethoxy)phenyl]ethyl]urea |
|---|---|
| PubChem CID | 86875382 |
| Molecular Formula | C26H27N3O3 |
| Molecular Weight | 429.52 g/mol |
| Exact Mass | 429.21 |
| IUPAC Name | 1-[2-(4-prop-2-ynoxyphenyl)ethyl]-3-[1-[4-(pyridin-3-ylmethoxy)phenyl]ethyl]urea |
| SMILES | C#CCOc1ccc(CCNC(=O)NC(C)c2ccc(OCc3cccnc3)cc2)cc1 |
| InChI | InChI=1S/C26H27N3O3/c1-3-17-31-24-10-6-21(7-11-24)14-16-28-26(30)29-20(2)23-8-12-25(13-9-23)32-19-22-5-4-15-27-18-22/h1,4-13,15,18,20H,14,16-17,19H2,2H3,(H2,28,29,30) |
| InChIKey | IXOVBPYKAFJHJW-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 72.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.52 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|