C19H19F2NO4 — CID 60609905
methyl 2-[4-(2,4-difluorophenoxy)butanoylamino]-2-phenylacetate (PubChem CID 60609905) has the molecular formula C19H19F2NO4 and a molecular weight of 363.36 g/mol. Its IUPAC name is methyl 2-[4-(2,4-difluorophenoxy)butanoylamino]-2-phenylacetate.
| Compound Name | methyl 2-[4-(2,4-difluorophenoxy)butanoylamino]-2-phenylacetate |
|---|---|
| PubChem CID | 60609905 |
| Molecular Formula | C19H19F2NO4 |
| Molecular Weight | 363.36 g/mol |
| Exact Mass | 363.13 |
| IUPAC Name | methyl 2-[4-(2,4-difluorophenoxy)butanoylamino]-2-phenylacetate |
| SMILES | COC(=O)C(NC(=O)CCCOc1ccc(F)cc1F)c1ccccc1 |
| InChI | InChI=1S/C19H19F2NO4/c1-25-19(24)18(13-6-3-2-4-7-13)22-17(23)8-5-11-26-16-10-9-14(20)12-15(16)21/h2-4,6-7,9-10,12,18H,5,8,11H2,1H3,(H,22,23) |
| InChIKey | FSKZMLBGIFTNCN-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.36 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|