C16H25ClF2N2O2 — CID 119605711
N-(1-amino-2,3-dimethylbutan-2-yl)-4-(2,4-difluorophenoxy)butanamide;hydrochloride (PubChem CID 119605711) has the molecular formula C16H25ClF2N2O2 and a molecular weight of 350.84 g/mol. Its IUPAC name is N-(1-amino-2,3-dimethylbutan-2-yl)-4-(2,4-difluorophenoxy)butanamide;hydrochloride.
| Compound Name | N-(1-amino-2,3-dimethylbutan-2-yl)-4-(2,4-difluorophenoxy)butanamide;hydrochloride |
|---|---|
| PubChem CID | 119605711 |
| Molecular Formula | C16H25ClF2N2O2 |
| Molecular Weight | 350.84 g/mol |
| Exact Mass | 350.16 |
| IUPAC Name | N-(1-amino-2,3-dimethylbutan-2-yl)-4-(2,4-difluorophenoxy)butanamide;hydrochloride |
| SMILES | CC(C)C(C)(CN)NC(=O)CCCOc1ccc(F)cc1F.Cl |
| InChI | InChI=1S/C16H24F2N2O2.ClH/c1-11(2)16(3,10-19)20-15(21)5-4-8-22-14-7-6-12(17)9-13(14)18;/h6-7,9,11H,4-5,8,10,19H2,1-3H3,(H,20,21);1H |
| InChIKey | GPHRWDZQPJJNBO-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.84 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|