C17H27N3O3 — CID 11937802
2-[(1R,2S,4S)-2-bicyclo[2.2.1]heptanyl]-N'-[2-(2-oxoazepan-1-yl)acetyl]acetohydrazide (PubChem CID 11937802) has the molecular formula C17H27N3O3 and a molecular weight of 321.42 g/mol. Its IUPAC name is 2-[(1R,2S,4S)-2-bicyclo[2.2.1]heptanyl]-N'-[2-(2-oxoazepan-1-yl)acetyl]acetohydrazide.
| Compound Name | 2-[(1R,2S,4S)-2-bicyclo[2.2.1]heptanyl]-N'-[2-(2-oxoazepan-1-yl)acetyl]acetohydrazide |
|---|---|
| PubChem CID | 11937802 |
| Molecular Formula | C17H27N3O3 |
| Molecular Weight | 321.42 g/mol |
| Exact Mass | 321.21 |
| IUPAC Name | 2-[(1R,2S,4S)-2-bicyclo[2.2.1]heptanyl]-N'-[2-(2-oxoazepan-1-yl)acetyl]acetohydrazide |
| SMILES | O=C(C[C@@H]1C[C@H]2CC[C@@H]1C2)NNC(=O)CN1CCCCCC1=O |
| InChI | InChI=1S/C17H27N3O3/c21-15(10-14-9-12-5-6-13(14)8-12)18-19-16(22)11-20-7-3-1-2-4-17(20)23/h12-14H,1-11H2,(H,18,21)(H,19,22)/t12-,13+,14-/m0/s1 |
| InChIKey | DEGJFBPWNJEAFH-MJBXVCDLSA-N |
| XLogP | 1.36 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.42 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|