C21H30N2OS — CID 95986165
(1S)-N-[[1-[(2-methylsulfanylphenyl)methyl]piperidin-4-yl]methyl]cyclohex-3-ene-1-carboxamide (PubChem CID 95986165) has the molecular formula C21H30N2OS and a molecular weight of 358.55 g/mol. Its IUPAC name is (1S)-N-[[1-[(2-methylsulfanylphenyl)methyl]piperidin-4-yl]methyl]cyclohex-3-ene-1-carboxamide.
| Compound Name | (1S)-N-[[1-[(2-methylsulfanylphenyl)methyl]piperidin-4-yl]methyl]cyclohex-3-ene-1-carboxamide |
|---|---|
| PubChem CID | 95986165 |
| Molecular Formula | C21H30N2OS |
| Molecular Weight | 358.55 g/mol |
| Exact Mass | 358.21 |
| IUPAC Name | (1S)-N-[[1-[(2-methylsulfanylphenyl)methyl]piperidin-4-yl]methyl]cyclohex-3-ene-1-carboxamide |
| SMILES | CSc1ccccc1CN1CCC(CNC(=O)[C@@H]2CC=CCC2)CC1 |
| InChI | InChI=1S/C21H30N2OS/c1-25-20-10-6-5-9-19(20)16-23-13-11-17(12-14-23)15-22-21(24)18-7-3-2-4-8-18/h2-3,5-6,9-10,17-18H,4,7-8,11-16H2,1H3,(H,22,24)/t18-/m1/s1 |
| InChIKey | VFNINAGSDTZSKM-GOSISDBHSA-N |
| XLogP | 4.09 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.55 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|