C21H30N2O2 — CID 99845328
(1S)-N-[[2-[[(2R,6R)-2,6-dimethylmorpholin-4-yl]methyl]phenyl]methyl]cyclohex-3-ene-1-carboxamide (PubChem CID 99845328) has the molecular formula C21H30N2O2 and a molecular weight of 342.48 g/mol. Its IUPAC name is (1S)-N-[[2-[[(2R,6R)-2,6-dimethylmorpholin-4-yl]methyl]phenyl]methyl]cyclohex-3-ene-1-carboxamide.
| Compound Name | (1S)-N-[[2-[[(2R,6R)-2,6-dimethylmorpholin-4-yl]methyl]phenyl]methyl]cyclohex-3-ene-1-carboxamide |
|---|---|
| PubChem CID | 99845328 |
| Molecular Formula | C21H30N2O2 |
| Molecular Weight | 342.48 g/mol |
| Exact Mass | 342.23 |
| IUPAC Name | (1S)-N-[[2-[[(2R,6R)-2,6-dimethylmorpholin-4-yl]methyl]phenyl]methyl]cyclohex-3-ene-1-carboxamide |
| SMILES | C[C@@H]1CN(Cc2ccccc2CNC(=O)[C@@H]2CC=CCC2)C[C@@H](C)O1 |
| InChI | InChI=1S/C21H30N2O2/c1-16-13-23(14-17(2)25-16)15-20-11-7-6-10-19(20)12-22-21(24)18-8-4-3-5-9-18/h3-4,6-7,10-11,16-18H,5,8-9,12-15H2,1-2H3,(H,22,24)/t16-,17-,18-/m1/s1 |
| InChIKey | PSJNSYUHWJLTFE-KZNAEPCWSA-N |
| XLogP | 3.27 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.48 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|