C16H28N2O2 — CID 42958334
N-[2-(2,6-dimethylmorpholin-4-yl)propyl]cyclohex-3-ene-1-carboxamide (PubChem CID 42958334) has the molecular formula C16H28N2O2 and a molecular weight of 280.41 g/mol. Its IUPAC name is N-[2-(2,6-dimethylmorpholin-4-yl)propyl]cyclohex-3-ene-1-carboxamide.
| Compound Name | N-[2-(2,6-dimethylmorpholin-4-yl)propyl]cyclohex-3-ene-1-carboxamide |
|---|---|
| PubChem CID | 42958334 |
| Molecular Formula | C16H28N2O2 |
| Molecular Weight | 280.41 g/mol |
| Exact Mass | 280.22 |
| IUPAC Name | N-[2-(2,6-dimethylmorpholin-4-yl)propyl]cyclohex-3-ene-1-carboxamide |
| SMILES | CC1CN(C(C)CNC(=O)C2CC=CCC2)CC(C)O1 |
| InChI | InChI=1S/C16H28N2O2/c1-12(18-10-13(2)20-14(3)11-18)9-17-16(19)15-7-5-4-6-8-15/h4-5,12-15H,6-11H2,1-3H3,(H,17,19) |
| InChIKey | PFUMOTIAFCIVSI-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.41 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|