C14H18FNO2S — CID 94414053
2-(2-fluorophenyl)sulfanyl-N-[(1R,2R)-2-hydroxycyclohexyl]acetamide (PubChem CID 94414053) has the molecular formula C14H18FNO2S and a molecular weight of 283.37 g/mol. Its IUPAC name is 2-(2-fluorophenyl)sulfanyl-N-[(1R,2R)-2-hydroxycyclohexyl]acetamide.
| Compound Name | 2-(2-fluorophenyl)sulfanyl-N-[(1R,2R)-2-hydroxycyclohexyl]acetamide |
|---|---|
| PubChem CID | 94414053 |
| Molecular Formula | C14H18FNO2S |
| Molecular Weight | 283.37 g/mol |
| Exact Mass | 283.10 |
| IUPAC Name | 2-(2-fluorophenyl)sulfanyl-N-[(1R,2R)-2-hydroxycyclohexyl]acetamide |
| SMILES | O=C(CSc1ccccc1F)N[C@@H]1CCCC[C@H]1O |
| InChI | InChI=1S/C14H18FNO2S/c15-10-5-1-4-8-13(10)19-9-14(18)16-11-6-2-3-7-12(11)17/h1,4-5,8,11-12,17H,2-3,6-7,9H2,(H,16,18)/t11-,12-/m1/s1 |
| InChIKey | DMDSDHSYPWZUPA-VXGBXAGGSA-N |
| XLogP | 2.34 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.37 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |