C15H20ClNO2S — CID 104927683
3-(4-chlorophenyl)sulfanyl-N-[(1R,2R)-2-hydroxycyclohexyl]propanamide (PubChem CID 104927683) has the molecular formula C15H20ClNO2S and a molecular weight of 313.85 g/mol. Its IUPAC name is 3-(4-chlorophenyl)sulfanyl-N-[(1R,2R)-2-hydroxycyclohexyl]propanamide.
| Compound Name | 3-(4-chlorophenyl)sulfanyl-N-[(1R,2R)-2-hydroxycyclohexyl]propanamide |
|---|---|
| PubChem CID | 104927683 |
| Molecular Formula | C15H20ClNO2S |
| Molecular Weight | 313.85 g/mol |
| Exact Mass | 313.09 |
| IUPAC Name | 3-(4-chlorophenyl)sulfanyl-N-[(1R,2R)-2-hydroxycyclohexyl]propanamide |
| SMILES | O=C(CCSc1ccc(Cl)cc1)N[C@@H]1CCCC[C@H]1O |
| InChI | InChI=1S/C15H20ClNO2S/c16-11-5-7-12(8-6-11)20-10-9-15(19)17-13-3-1-2-4-14(13)18/h5-8,13-14,18H,1-4,9-10H2,(H,17,19)/t13-,14-/m1/s1 |
| InChIKey | XLVIKJICLRVWMV-ZIAGYGMSSA-N |
| XLogP | 3.24 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.85 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |