C18H28N2O4S2 — CID 75524521
N-(1,1-dioxothiolan-3-yl)-1-(3-propan-2-ylphenyl)sulfonylpiperidin-4-amine (PubChem CID 75524521) has the molecular formula C18H28N2O4S2 and a molecular weight of 400.57 g/mol. Its IUPAC name is N-(1,1-dioxothiolan-3-yl)-1-(3-propan-2-ylphenyl)sulfonylpiperidin-4-amine.
| Compound Name | N-(1,1-dioxothiolan-3-yl)-1-(3-propan-2-ylphenyl)sulfonylpiperidin-4-amine |
|---|---|
| PubChem CID | 75524521 |
| Molecular Formula | C18H28N2O4S2 |
| Molecular Weight | 400.57 g/mol |
| Exact Mass | 400.15 |
| IUPAC Name | N-(1,1-dioxothiolan-3-yl)-1-(3-propan-2-ylphenyl)sulfonylpiperidin-4-amine |
| SMILES | CC(C)c1cccc(S(=O)(=O)N2CCC(NC3CCS(=O)(=O)C3)CC2)c1 |
| InChI | InChI=1S/C18H28N2O4S2/c1-14(2)15-4-3-5-18(12-15)26(23,24)20-9-6-16(7-10-20)19-17-8-11-25(21,22)13-17/h3-5,12,14,16-17,19H,6-11,13H2,1-2H3 |
| InChIKey | AUHMLMDJRGTZRL-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.57 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |