C11H13N5O2S — CID 63162681
1,1-dioxo-N-[2-(tetrazol-1-yl)phenyl]thiolan-3-amine (PubChem CID 63162681) has the molecular formula C11H13N5O2S and a molecular weight of 279.32 g/mol. Its IUPAC name is 1,1-dioxo-N-[2-(tetrazol-1-yl)phenyl]thiolan-3-amine.
| Compound Name | 1,1-dioxo-N-[2-(tetrazol-1-yl)phenyl]thiolan-3-amine |
|---|---|
| PubChem CID | 63162681 |
| Molecular Formula | C11H13N5O2S |
| Molecular Weight | 279.32 g/mol |
| Exact Mass | 279.08 |
| IUPAC Name | 1,1-dioxo-N-[2-(tetrazol-1-yl)phenyl]thiolan-3-amine |
| SMILES | O=S1(=O)CCC(Nc2ccccc2-n2cnnn2)C1 |
| InChI | InChI=1S/C11H13N5O2S/c17-19(18)6-5-9(7-19)13-10-3-1-2-4-11(10)16-8-12-14-15-16/h1-4,8-9,13H,5-7H2 |
| InChIKey | ZAJXBBDWYXMZPK-UHFFFAOYSA-N |
| XLogP | 0.26 |
| TPSA | 89.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.32 |
| LogP ≤ 5 | 0.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |