C12H12FN5O3S — CID 42534528
N-[(3S)-1,1-dioxothiolan-3-yl]-5-fluoro-2-(tetrazol-1-yl)benzamide (PubChem CID 42534528) has the molecular formula C12H12FN5O3S and a molecular weight of 325.32 g/mol. Its IUPAC name is N-[(3S)-1,1-dioxothiolan-3-yl]-5-fluoro-2-(tetrazol-1-yl)benzamide.
| Compound Name | N-[(3S)-1,1-dioxothiolan-3-yl]-5-fluoro-2-(tetrazol-1-yl)benzamide |
|---|---|
| PubChem CID | 42534528 |
| Molecular Formula | C12H12FN5O3S |
| Molecular Weight | 325.32 g/mol |
| Exact Mass | 325.06 |
| IUPAC Name | N-[(3S)-1,1-dioxothiolan-3-yl]-5-fluoro-2-(tetrazol-1-yl)benzamide |
| SMILES | O=C(N[C@H]1CCS(=O)(=O)C1)c1cc(F)ccc1-n1cnnn1 |
| InChI | InChI=1S/C12H12FN5O3S/c13-8-1-2-11(18-7-14-16-17-18)10(5-8)12(19)15-9-3-4-22(20,21)6-9/h1-2,5,7,9H,3-4,6H2,(H,15,19)/t9-/m0/s1 |
| InChIKey | QXBLDFGVBKEMQY-VIFPVBQESA-N |
| XLogP | -0.28 |
| TPSA | 106.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.32 |
| LogP ≤ 5 | -0.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |