C15H18N6O — CID 119456565
N-(8-azabicyclo[3.2.1]octan-3-yl)-2-(tetrazol-1-yl)benzamide (PubChem CID 119456565) has the molecular formula C15H18N6O and a molecular weight of 298.35 g/mol. Its IUPAC name is N-(8-azabicyclo[3.2.1]octan-3-yl)-2-(tetrazol-1-yl)benzamide.
| Compound Name | N-(8-azabicyclo[3.2.1]octan-3-yl)-2-(tetrazol-1-yl)benzamide |
|---|---|
| PubChem CID | 119456565 |
| Molecular Formula | C15H18N6O |
| Molecular Weight | 298.35 g/mol |
| Exact Mass | 298.15 |
| IUPAC Name | N-(8-azabicyclo[3.2.1]octan-3-yl)-2-(tetrazol-1-yl)benzamide |
| SMILES | O=C(NC1CC2CCC(C1)N2)c1ccccc1-n1cnnn1 |
| InChI | InChI=1S/C15H18N6O/c22-15(18-12-7-10-5-6-11(8-12)17-10)13-3-1-2-4-14(13)21-9-16-19-20-21/h1-4,9-12,17H,5-8H2,(H,18,22) |
| InChIKey | YBQQOVAFQAGPOL-UHFFFAOYSA-N |
| XLogP | 0.68 |
| TPSA | 84.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.35 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |