C13H11N7O2 — CID 78828822
N'-[2-(tetrazol-1-yl)benzoyl]-1H-pyrrole-2-carbohydrazide (PubChem CID 78828822) has the molecular formula C13H11N7O2 and a molecular weight of 297.28 g/mol. Its IUPAC name is N'-[2-(tetrazol-1-yl)benzoyl]-1H-pyrrole-2-carbohydrazide.
| Compound Name | N'-[2-(tetrazol-1-yl)benzoyl]-1H-pyrrole-2-carbohydrazide |
|---|---|
| PubChem CID | 78828822 |
| Molecular Formula | C13H11N7O2 |
| Molecular Weight | 297.28 g/mol |
| Exact Mass | 297.10 |
| IUPAC Name | N'-[2-(tetrazol-1-yl)benzoyl]-1H-pyrrole-2-carbohydrazide |
| SMILES | O=C(NNC(=O)c1ccccc1-n1cnnn1)c1ccc[nH]1 |
| InChI | InChI=1S/C13H11N7O2/c21-12(16-17-13(22)10-5-3-7-14-10)9-4-1-2-6-11(9)20-8-15-18-19-20/h1-8,14H,(H,16,21)(H,17,22) |
| InChIKey | DDIYBIBWFBIUAB-UHFFFAOYSA-N |
| XLogP | 0.07 |
| TPSA | 117.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.28 |
| LogP ≤ 5 | 0.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|