C15H13N5O2 — CID 78887623
N'-(2-pyrazol-1-ylbenzoyl)-1H-pyrrole-2-carbohydrazide (PubChem CID 78887623) has the molecular formula C15H13N5O2 and a molecular weight of 295.30 g/mol. Its IUPAC name is N'-(2-pyrazol-1-ylbenzoyl)-1H-pyrrole-2-carbohydrazide.
| Compound Name | N'-(2-pyrazol-1-ylbenzoyl)-1H-pyrrole-2-carbohydrazide |
|---|---|
| PubChem CID | 78887623 |
| Molecular Formula | C15H13N5O2 |
| Molecular Weight | 295.30 g/mol |
| Exact Mass | 295.11 |
| IUPAC Name | N'-(2-pyrazol-1-ylbenzoyl)-1H-pyrrole-2-carbohydrazide |
| SMILES | O=C(NNC(=O)c1ccccc1-n1cccn1)c1ccc[nH]1 |
| InChI | InChI=1S/C15H13N5O2/c21-14(18-19-15(22)12-6-3-8-16-12)11-5-1-2-7-13(11)20-10-4-9-17-20/h1-10,16H,(H,18,21)(H,19,22) |
| InChIKey | FYQNMGBRDLFABA-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 91.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.30 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|