C19H16Cl2N4O2 — CID 78888408
3,4-dichloro-N-[2-[(2-pyrazol-1-ylbenzoyl)amino]ethyl]benzamide (PubChem CID 78888408) has the molecular formula C19H16Cl2N4O2 and a molecular weight of 403.27 g/mol. Its IUPAC name is 3,4-dichloro-N-[2-[(2-pyrazol-1-ylbenzoyl)amino]ethyl]benzamide.
| Compound Name | 3,4-dichloro-N-[2-[(2-pyrazol-1-ylbenzoyl)amino]ethyl]benzamide |
|---|---|
| PubChem CID | 78888408 |
| Molecular Formula | C19H16Cl2N4O2 |
| Molecular Weight | 403.27 g/mol |
| Exact Mass | 402.07 |
| IUPAC Name | 3,4-dichloro-N-[2-[(2-pyrazol-1-ylbenzoyl)amino]ethyl]benzamide |
| SMILES | O=C(NCCNC(=O)c1ccccc1-n1cccn1)c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C19H16Cl2N4O2/c20-15-7-6-13(12-16(15)21)18(26)22-9-10-23-19(27)14-4-1-2-5-17(14)25-11-3-8-24-25/h1-8,11-12H,9-10H2,(H,22,26)(H,23,27) |
| InChIKey | KYNSTQQBTJWYDV-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 76.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.27 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|