C18H17N5O — CID 4879166
N-(1,2,3,4-tetrahydronaphthalen-1-yl)-2-(tetrazol-1-yl)benzamide (PubChem CID 4879166) has the molecular formula C18H17N5O and a molecular weight of 319.37 g/mol. Its IUPAC name is N-(1,2,3,4-tetrahydronaphthalen-1-yl)-2-(tetrazol-1-yl)benzamide.
| Compound Name | N-(1,2,3,4-tetrahydronaphthalen-1-yl)-2-(tetrazol-1-yl)benzamide |
|---|---|
| PubChem CID | 4879166 |
| Molecular Formula | C18H17N5O |
| Molecular Weight | 319.37 g/mol |
| Exact Mass | 319.14 |
| IUPAC Name | N-(1,2,3,4-tetrahydronaphthalen-1-yl)-2-(tetrazol-1-yl)benzamide |
| SMILES | O=C(NC1CCCc2ccccc21)c1ccccc1-n1cnnn1 |
| InChI | InChI=1S/C18H17N5O/c24-18(15-9-3-4-11-17(15)23-12-19-21-22-23)20-16-10-5-7-13-6-1-2-8-14(13)16/h1-4,6,8-9,11-12,16H,5,7,10H2,(H,20,24) |
| InChIKey | JPPGPLRBLVODKI-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 72.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.37 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |