C19H21NO3S — CID 8777527
2-ethylsulfonyl-N-[(1R)-1,2,3,4-tetrahydronaphthalen-1-yl]benzamide (PubChem CID 8777527) has the molecular formula C19H21NO3S and a molecular weight of 343.45 g/mol. Its IUPAC name is 2-ethylsulfonyl-N-[(1R)-1,2,3,4-tetrahydronaphthalen-1-yl]benzamide.
| Compound Name | 2-ethylsulfonyl-N-[(1R)-1,2,3,4-tetrahydronaphthalen-1-yl]benzamide |
|---|---|
| PubChem CID | 8777527 |
| Molecular Formula | C19H21NO3S |
| Molecular Weight | 343.45 g/mol |
| Exact Mass | 343.12 |
| IUPAC Name | 2-ethylsulfonyl-N-[(1R)-1,2,3,4-tetrahydronaphthalen-1-yl]benzamide |
| SMILES | CCS(=O)(=O)c1ccccc1C(=O)N[C@@H]1CCCc2ccccc21 |
| InChI | InChI=1S/C19H21NO3S/c1-2-24(22,23)18-13-6-5-11-16(18)19(21)20-17-12-7-9-14-8-3-4-10-15(14)17/h3-6,8,10-11,13,17H,2,7,9,12H2,1H3,(H,20,21)/t17-/m1/s1 |
| InChIKey | IXOSTFYPDAURKT-QGZVFWFLSA-N |
| XLogP | 3.29 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.45 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |