C18H20N2O — CID 60682216
2-amino-3-methyl-N-(1,2,3,4-tetrahydronaphthalen-1-yl)benzamide (PubChem CID 60682216) has the molecular formula C18H20N2O and a molecular weight of 280.37 g/mol. Its IUPAC name is 2-amino-3-methyl-N-(1,2,3,4-tetrahydronaphthalen-1-yl)benzamide.
| Compound Name | 2-amino-3-methyl-N-(1,2,3,4-tetrahydronaphthalen-1-yl)benzamide |
|---|---|
| PubChem CID | 60682216 |
| Molecular Formula | C18H20N2O |
| Molecular Weight | 280.37 g/mol |
| Exact Mass | 280.16 |
| IUPAC Name | 2-amino-3-methyl-N-(1,2,3,4-tetrahydronaphthalen-1-yl)benzamide |
| SMILES | Cc1cccc(C(=O)NC2CCCc3ccccc32)c1N |
| InChI | InChI=1S/C18H20N2O/c1-12-6-4-10-15(17(12)19)18(21)20-16-11-5-8-13-7-2-3-9-14(13)16/h2-4,6-7,9-10,16H,5,8,11,19H2,1H3,(H,20,21) |
| InChIKey | BGHSREXBHSRAAM-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.37 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|