C8H10N6O2S — CID 47136339
N-(1,1-dioxothiolan-3-yl)tetrazolo[1,5-b]pyridazin-6-amine (PubChem CID 47136339) has the molecular formula C8H10N6O2S and a molecular weight of 254.27 g/mol. Its IUPAC name is N-(1,1-dioxothiolan-3-yl)tetrazolo[1,5-b]pyridazin-6-amine.
| Compound Name | N-(1,1-dioxothiolan-3-yl)tetrazolo[1,5-b]pyridazin-6-amine |
|---|---|
| PubChem CID | 47136339 |
| Molecular Formula | C8H10N6O2S |
| Molecular Weight | 254.27 g/mol |
| Exact Mass | 254.06 |
| IUPAC Name | N-(1,1-dioxothiolan-3-yl)tetrazolo[1,5-b]pyridazin-6-amine |
| SMILES | O=S1(=O)CCC(Nc2ccc3nnnn3n2)C1 |
| InChI | InChI=1S/C8H10N6O2S/c15-17(16)4-3-6(5-17)9-7-1-2-8-10-12-13-14(8)11-7/h1-2,6H,3-5H2,(H,9,11) |
| InChIKey | RIEAFNHDPQMRGT-UHFFFAOYSA-N |
| XLogP | -0.88 |
| TPSA | 102.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.27 |
| LogP ≤ 5 | -0.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |