C13H20N2O2S — CID 115376309
1-N-(1,1-dioxothian-3-yl)-3-N,3-N-dimethylbenzene-1,3-diamine (PubChem CID 115376309) has the molecular formula C13H20N2O2S and a molecular weight of 268.38 g/mol. Its IUPAC name is 1-N-(1,1-dioxothian-3-yl)-3-N,3-N-dimethylbenzene-1,3-diamine.
| Compound Name | 1-N-(1,1-dioxothian-3-yl)-3-N,3-N-dimethylbenzene-1,3-diamine |
|---|---|
| PubChem CID | 115376309 |
| Molecular Formula | C13H20N2O2S |
| Molecular Weight | 268.38 g/mol |
| Exact Mass | 268.12 |
| IUPAC Name | 1-N-(1,1-dioxothian-3-yl)-3-N,3-N-dimethylbenzene-1,3-diamine |
| SMILES | CN(C)c1cccc(NC2CCCS(=O)(=O)C2)c1 |
| InChI | InChI=1S/C13H20N2O2S/c1-15(2)13-7-3-5-11(9-13)14-12-6-4-8-18(16,17)10-12/h3,5,7,9,12,14H,4,6,8,10H2,1-2H3 |
| InChIKey | SPMOAWUUTQYPHB-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.38 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |