About 3-N,3-N-dimethyl-1-N-(4-propan-2-ylcyclohexyl)benzene-1,3-diamine
3-N,3-N-dimethyl-1-N-(4-propan-2-ylcyclohexyl)benzene-1,3-diamine (PubChem CID 115375907) has the molecular formula C17H28N2
and a molecular weight of 260.43 g/mol. Its IUPAC name is 3-N,3-N-dimethyl-1-N-(4-propan-2-ylcyclohexyl)benzene-1,3-diamine.
Molecular Properties
| Compound Name | 3-N,3-N-dimethyl-1-N-(4-propan-2-ylcyclohexyl)benzene-1,3-diamine |
| PubChem CID | 115375907 |
| Molecular Formula | C17H28N2 |
| Molecular Weight | 260.43 g/mol |
| Exact Mass | 260.23 |
| IUPAC Name | 3-N,3-N-dimethyl-1-N-(4-propan-2-ylcyclohexyl)benzene-1,3-diamine |
| SMILES | CC(C)C1CCC(Nc2cccc(N(C)C)c2)CC1 |
| InChI | InChI=1S/C17H28N2/c1-13(2)14-8-10-15(11-9-14)18-16-6-5-7-17(12-16)19(3)4/h5-7,12-15,18H,8-11H2,1-4H3 |
| InChIKey | QKMJHKCVXZUEIT-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 260.43 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-N,3-N-dimethyl-1-N-(4-propan-2-ylcyclohexyl)benzene-1,3-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-N,3-N-dimethyl-1-N-(4-propan-2-ylcyclohexyl)benzene-1,3-diamine?
The IUPAC name of 3-N,3-N-dimethyl-1-N-(4-propan-2-ylcyclohexyl)benzene-1,3-diamine (CID 115375907) is 3-N,3-N-dimethyl-1-N-(4-propan-2-ylcyclohexyl)benzene-1,3-diamine.
What is the SMILES notation for 3-N,3-N-dimethyl-1-N-(4-propan-2-ylcyclohexyl)benzene-1,3-diamine?
The canonical SMILES for 3-N,3-N-dimethyl-1-N-(4-propan-2-ylcyclohexyl)benzene-1,3-diamine is CC(C)C1CCC(Nc2cccc(N(C)C)c2)CC1.
What is the InChIKey of 3-N,3-N-dimethyl-1-N-(4-propan-2-ylcyclohexyl)benzene-1,3-diamine?
The InChIKey is QKMJHKCVXZUEIT-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H28N2/c1-13(2)14-8-10-15(11-9-14)18-16-6-5-7-17(12-16)19(3)4/h5-7,12-15,18H,8-11H2,1-4H3.
What are the key properties of 3-N,3-N-dimethyl-1-N-(4-propan-2-ylcyclohexyl)benzene-1,3-diamine?
3-N,3-N-dimethyl-1-N-(4-propan-2-ylcyclohexyl)benzene-1,3-diamine has a molecular weight of 260.43 g/mol, XLogP of 4.38, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-N,3-N-dimethyl-1-N-(4-propan-2-ylcyclohexyl)benzene-1,3-diamine is sourced from PubChem (CID 115375907), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).