C14H19ClN2O4S — CID 94813762
1-(5-chloro-2-propoxyphenyl)-3-[(3R)-1,1-dioxothiolan-3-yl]urea (PubChem CID 94813762) has the molecular formula C14H19ClN2O4S and a molecular weight of 346.84 g/mol. Its IUPAC name is 1-(5-chloro-2-propoxyphenyl)-3-[(3R)-1,1-dioxothiolan-3-yl]urea.
| Compound Name | 1-(5-chloro-2-propoxyphenyl)-3-[(3R)-1,1-dioxothiolan-3-yl]urea |
|---|---|
| PubChem CID | 94813762 |
| Molecular Formula | C14H19ClN2O4S |
| Molecular Weight | 346.84 g/mol |
| Exact Mass | 346.08 |
| IUPAC Name | 1-(5-chloro-2-propoxyphenyl)-3-[(3R)-1,1-dioxothiolan-3-yl]urea |
| SMILES | CCCOc1ccc(Cl)cc1NC(=O)N[C@@H]1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C14H19ClN2O4S/c1-2-6-21-13-4-3-10(15)8-12(13)17-14(18)16-11-5-7-22(19,20)9-11/h3-4,8,11H,2,5-7,9H2,1H3,(H2,16,17,18)/t11-/m1/s1 |
| InChIKey | ZAJJOGXLVQWEGU-LLVKDONJSA-N |
| XLogP | 2.44 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.84 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |