C16H23N3O3 — CID 6465197
methyl 2-[(1-ethylpiperidin-4-yl)carbamoylamino]benzoate (PubChem CID 6465197) has the molecular formula C16H23N3O3 and a molecular weight of 305.38 g/mol. Its IUPAC name is methyl 2-[(1-ethylpiperidin-4-yl)carbamoylamino]benzoate.
| Compound Name | methyl 2-[(1-ethylpiperidin-4-yl)carbamoylamino]benzoate |
|---|---|
| PubChem CID | 6465197 |
| Molecular Formula | C16H23N3O3 |
| Molecular Weight | 305.38 g/mol |
| Exact Mass | 305.17 |
| IUPAC Name | methyl 2-[(1-ethylpiperidin-4-yl)carbamoylamino]benzoate |
| SMILES | CCN1CCC(NC(=O)Nc2ccccc2C(=O)OC)CC1 |
| InChI | InChI=1S/C16H23N3O3/c1-3-19-10-8-12(9-11-19)17-16(21)18-14-7-5-4-6-13(14)15(20)22-2/h4-7,12H,3,8-11H2,1-2H3,(H2,17,18,21) |
| InChIKey | RQOSINBYDBZFKX-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.38 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |