C20H22N4O2 — CID 112904866
2-N-(2-ethoxyphenyl)-4-N-(4-ethoxyphenyl)pyrimidine-2,4-diamine (PubChem CID 112904866) has the molecular formula C20H22N4O2 and a molecular weight of 350.42 g/mol. Its IUPAC name is 2-N-(2-ethoxyphenyl)-4-N-(4-ethoxyphenyl)pyrimidine-2,4-diamine.
| Compound Name | 2-N-(2-ethoxyphenyl)-4-N-(4-ethoxyphenyl)pyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 112904866 |
| Molecular Formula | C20H22N4O2 |
| Molecular Weight | 350.42 g/mol |
| Exact Mass | 350.17 |
| IUPAC Name | 2-N-(2-ethoxyphenyl)-4-N-(4-ethoxyphenyl)pyrimidine-2,4-diamine |
| SMILES | CCOc1ccc(Nc2ccnc(Nc3ccccc3OCC)n2)cc1 |
| InChI | InChI=1S/C20H22N4O2/c1-3-25-16-11-9-15(10-12-16)22-19-13-14-21-20(24-19)23-17-7-5-6-8-18(17)26-4-2/h5-14H,3-4H2,1-2H3,(H2,21,22,23,24) |
| InChIKey | GFDZSZYNWVUOQF-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 68.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.42 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |