C25H14F3N5O — CID 155566782
4-[4-[2-(4-cyanoanilino)pyrimidin-4-yl]oxy-2-(trifluoromethyl)phenyl]benzonitrile (PubChem CID 155566782) has the molecular formula C25H14F3N5O and a molecular weight of 457.42 g/mol. Its IUPAC name is 4-[4-[2-(4-cyanoanilino)pyrimidin-4-yl]oxy-2-(trifluoromethyl)phenyl]benzonitrile.
| Compound Name | 4-[4-[2-(4-cyanoanilino)pyrimidin-4-yl]oxy-2-(trifluoromethyl)phenyl]benzonitrile |
|---|---|
| PubChem CID | 155566782 |
| Molecular Formula | C25H14F3N5O |
| Molecular Weight | 457.42 g/mol |
| Exact Mass | 457.12 |
| IUPAC Name | 4-[4-[2-(4-cyanoanilino)pyrimidin-4-yl]oxy-2-(trifluoromethyl)phenyl]benzonitrile |
| SMILES | N#Cc1ccc(Nc2nccc(Oc3ccc(-c4ccc(C#N)cc4)c(C(F)(F)F)c3)n2)cc1 |
| InChI | InChI=1S/C25H14F3N5O/c26-25(27,28)22-13-20(9-10-21(22)18-5-1-16(14-29)2-6-18)34-23-11-12-31-24(33-23)32-19-7-3-17(15-30)4-8-19/h1-13H,(H,31,32,33) |
| InChIKey | WZKANNTWFHQQBH-UHFFFAOYSA-N |
| XLogP | 6.44 |
| TPSA | 94.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.42 |
| LogP ≤ 5 | 6.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |