C27H21N5O2 — CID 76579643
4-[[4-[(1-phenylmethoxyimino-2,3-dihydroinden-5-yl)oxy]pyrimidin-2-yl]amino]benzonitrile (PubChem CID 76579643) has the molecular formula C27H21N5O2 and a molecular weight of 447.50 g/mol. Its IUPAC name is 4-[[4-[(1-phenylmethoxyimino-2,3-dihydroinden-5-yl)oxy]pyrimidin-2-yl]amino]benzonitrile.
| Compound Name | 4-[[4-[(1-phenylmethoxyimino-2,3-dihydroinden-5-yl)oxy]pyrimidin-2-yl]amino]benzonitrile |
|---|---|
| PubChem CID | 76579643 |
| Molecular Formula | C27H21N5O2 |
| Molecular Weight | 447.50 g/mol |
| Exact Mass | 447.17 |
| IUPAC Name | 4-[[4-[(1-phenylmethoxyimino-2,3-dihydroinden-5-yl)oxy]pyrimidin-2-yl]amino]benzonitrile |
| SMILES | N#Cc1ccc(Nc2nccc(Oc3ccc4c(c3)CCC4=NOCc3ccccc3)n2)cc1 |
| InChI | InChI=1S/C27H21N5O2/c28-17-19-6-9-22(10-7-19)30-27-29-15-14-26(31-27)34-23-11-12-24-21(16-23)8-13-25(24)32-33-18-20-4-2-1-3-5-20/h1-7,9-12,14-16H,8,13,18H2,(H,29,30,31) |
| InChIKey | DXFKERNQGYLWSU-UHFFFAOYSA-N |
| XLogP | 5.75 |
| TPSA | 92.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.50 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|