C20H18N4O2 — CID 71740451
4-[[4-[4-(2-methoxyethyl)phenoxy]pyrimidin-2-yl]amino]benzonitrile (PubChem CID 71740451) has the molecular formula C20H18N4O2 and a molecular weight of 346.39 g/mol. Its IUPAC name is 4-[[4-[4-(2-methoxyethyl)phenoxy]pyrimidin-2-yl]amino]benzonitrile.
| Compound Name | 4-[[4-[4-(2-methoxyethyl)phenoxy]pyrimidin-2-yl]amino]benzonitrile |
|---|---|
| PubChem CID | 71740451 |
| Molecular Formula | C20H18N4O2 |
| Molecular Weight | 346.39 g/mol |
| Exact Mass | 346.14 |
| IUPAC Name | 4-[[4-[4-(2-methoxyethyl)phenoxy]pyrimidin-2-yl]amino]benzonitrile |
| SMILES | COCCc1ccc(Oc2ccnc(Nc3ccc(C#N)cc3)n2)cc1 |
| InChI | InChI=1S/C20H18N4O2/c1-25-13-11-15-4-8-18(9-5-15)26-19-10-12-22-20(24-19)23-17-6-2-16(14-21)3-7-17/h2-10,12H,11,13H2,1H3,(H,22,23,24) |
| InChIKey | SVTHTUGDZYKCIN-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 80.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.39 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |