C13H9F3N4O — CID 36569830
2-[4-[[4-(trifluoromethyl)pyrimidin-2-yl]amino]phenoxy]acetonitrile (PubChem CID 36569830) has the molecular formula C13H9F3N4O and a molecular weight of 294.24 g/mol. Its IUPAC name is 2-[4-[[4-(trifluoromethyl)pyrimidin-2-yl]amino]phenoxy]acetonitrile.
| Compound Name | 2-[4-[[4-(trifluoromethyl)pyrimidin-2-yl]amino]phenoxy]acetonitrile |
|---|---|
| PubChem CID | 36569830 |
| Molecular Formula | C13H9F3N4O |
| Molecular Weight | 294.24 g/mol |
| Exact Mass | 294.07 |
| IUPAC Name | 2-[4-[[4-(trifluoromethyl)pyrimidin-2-yl]amino]phenoxy]acetonitrile |
| SMILES | N#CCOc1ccc(Nc2nccc(C(F)(F)F)n2)cc1 |
| InChI | InChI=1S/C13H9F3N4O/c14-13(15,16)11-5-7-18-12(20-11)19-9-1-3-10(4-2-9)21-8-6-17/h1-5,7H,8H2,(H,18,19,20) |
| InChIKey | VARLXLSKIQTEMU-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 70.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.24 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |