C13H18N2O — CID 61324519
2-[4-(2,2-dimethylpropylamino)phenoxy]acetonitrile (PubChem CID 61324519) has the molecular formula C13H18N2O and a molecular weight of 218.30 g/mol. Its IUPAC name is 2-[4-(2,2-dimethylpropylamino)phenoxy]acetonitrile.
| Compound Name | 2-[4-(2,2-dimethylpropylamino)phenoxy]acetonitrile |
|---|---|
| PubChem CID | 61324519 |
| Molecular Formula | C13H18N2O |
| Molecular Weight | 218.30 g/mol |
| Exact Mass | 218.14 |
| IUPAC Name | 2-[4-(2,2-dimethylpropylamino)phenoxy]acetonitrile |
| SMILES | CC(C)(C)CNc1ccc(OCC#N)cc1 |
| InChI | InChI=1S/C13H18N2O/c1-13(2,3)10-15-11-4-6-12(7-5-11)16-9-8-14/h4-7,15H,9-10H2,1-3H3 |
| InChIKey | RKNNTUFSQPODFX-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 45.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.30 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|