C15H11F3N2O — CID 63051864
2-[4-[(3,4,5-trifluorophenyl)methylamino]phenoxy]acetonitrile (PubChem CID 63051864) has the molecular formula C15H11F3N2O and a molecular weight of 292.26 g/mol. Its IUPAC name is 2-[4-[(3,4,5-trifluorophenyl)methylamino]phenoxy]acetonitrile.
| Compound Name | 2-[4-[(3,4,5-trifluorophenyl)methylamino]phenoxy]acetonitrile |
|---|---|
| PubChem CID | 63051864 |
| Molecular Formula | C15H11F3N2O |
| Molecular Weight | 292.26 g/mol |
| Exact Mass | 292.08 |
| IUPAC Name | 2-[4-[(3,4,5-trifluorophenyl)methylamino]phenoxy]acetonitrile |
| SMILES | N#CCOc1ccc(NCc2cc(F)c(F)c(F)c2)cc1 |
| InChI | InChI=1S/C15H11F3N2O/c16-13-7-10(8-14(17)15(13)18)9-20-11-1-3-12(4-2-11)21-6-5-19/h1-4,7-8,20H,6,9H2 |
| InChIKey | WPIIBOAKRCYGMX-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 45.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.26 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|