C24H22N4O3 — CID 143876816
4-[[4-[4-[3-(2-hydroxyethoxy)prop-1-ynyl]-2,6-dimethylphenoxy]pyrimidin-2-yl]amino]benzonitrile (PubChem CID 143876816) has the molecular formula C24H22N4O3 and a molecular weight of 414.47 g/mol. Its IUPAC name is 4-[[4-[4-[3-(2-hydroxyethoxy)prop-1-ynyl]-2,6-dimethylphenoxy]pyrimidin-2-yl]amino]benzonitrile.
| Compound Name | 4-[[4-[4-[3-(2-hydroxyethoxy)prop-1-ynyl]-2,6-dimethylphenoxy]pyrimidin-2-yl]amino]benzonitrile |
|---|---|
| PubChem CID | 143876816 |
| Molecular Formula | C24H22N4O3 |
| Molecular Weight | 414.47 g/mol |
| Exact Mass | 414.17 |
| IUPAC Name | 4-[[4-[4-[3-(2-hydroxyethoxy)prop-1-ynyl]-2,6-dimethylphenoxy]pyrimidin-2-yl]amino]benzonitrile |
| SMILES | Cc1cc(C#CCOCCO)cc(C)c1Oc1ccnc(Nc2ccc(C#N)cc2)n1 |
| InChI | InChI=1S/C24H22N4O3/c1-17-14-20(4-3-12-30-13-11-29)15-18(2)23(17)31-22-9-10-26-24(28-22)27-21-7-5-19(16-25)6-8-21/h5-10,14-15,29H,11-13H2,1-2H3,(H,26,27,28) |
| InChIKey | SZVWLUBCRJNODX-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 100.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.47 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|