About 4-[2-(3-fluoro-4-piperazin-1-ylanilino)pyrimidin-4-yl]oxy-3,5-dimethylbenzonitrile
4-[2-(3-fluoro-4-piperazin-1-ylanilino)pyrimidin-4-yl]oxy-3,5-dimethylbenzonitrile (PubChem CID 172852325) has the molecular formula C23H23FN6O
and a molecular weight of 418.48 g/mol. Its IUPAC name is 4-[2-(3-fluoro-4-piperazin-1-ylanilino)pyrimidin-4-yl]oxy-3,5-dimethylbenzonitrile.
Molecular Properties
| Compound Name | 4-[2-(3-fluoro-4-piperazin-1-ylanilino)pyrimidin-4-yl]oxy-3,5-dimethylbenzonitrile |
| PubChem CID | 172852325 |
| Molecular Formula | C23H23FN6O |
| Molecular Weight | 418.48 g/mol |
| Exact Mass | 418.19 |
| IUPAC Name | 4-[2-(3-fluoro-4-piperazin-1-ylanilino)pyrimidin-4-yl]oxy-3,5-dimethylbenzonitrile |
| SMILES | Cc1cc(C#N)cc(C)c1Oc1ccnc(Nc2ccc(N3CCNCC3)c(F)c2)n1 |
| InChI | InChI=1S/C23H23FN6O/c1-15-11-17(14-25)12-16(2)22(15)31-21-5-6-27-23(29-21)28-18-3-4-20(19(24)13-18)30-9-7-26-8-10-30/h3-6,11-13,26H,7-10H2,1-2H3,(H,27,28,29) |
| InChIKey | YFSOUJZNPBJSRN-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 86.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 418.48 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|
Analyze 4-[2-(3-fluoro-4-piperazin-1-ylanilino)pyrimidin-4-yl]oxy-3,5-dimethylbenzonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[2-(3-fluoro-4-piperazin-1-ylanilino)pyrimidin-4-yl]oxy-3,5-dimethylbenzonitrile?
The IUPAC name of 4-[2-(3-fluoro-4-piperazin-1-ylanilino)pyrimidin-4-yl]oxy-3,5-dimethylbenzonitrile (CID 172852325) is 4-[2-(3-fluoro-4-piperazin-1-ylanilino)pyrimidin-4-yl]oxy-3,5-dimethylbenzonitrile.
What is the SMILES notation for 4-[2-(3-fluoro-4-piperazin-1-ylanilino)pyrimidin-4-yl]oxy-3,5-dimethylbenzonitrile?
The canonical SMILES for 4-[2-(3-fluoro-4-piperazin-1-ylanilino)pyrimidin-4-yl]oxy-3,5-dimethylbenzonitrile is Cc1cc(C#N)cc(C)c1Oc1ccnc(Nc2ccc(N3CCNCC3)c(F)c2)n1.
What is the InChIKey of 4-[2-(3-fluoro-4-piperazin-1-ylanilino)pyrimidin-4-yl]oxy-3,5-dimethylbenzonitrile?
The InChIKey is YFSOUJZNPBJSRN-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H23FN6O/c1-15-11-17(14-25)12-16(2)22(15)31-21-5-6-27-23(29-21)28-18-3-4-20(19(24)13-18)30-9-7-26-8-10-30/h3-6,11-13,26H,7-10H2,1-2H3,(H,27,28,29).
What are the key properties of 4-[2-(3-fluoro-4-piperazin-1-ylanilino)pyrimidin-4-yl]oxy-3,5-dimethylbenzonitrile?
4-[2-(3-fluoro-4-piperazin-1-ylanilino)pyrimidin-4-yl]oxy-3,5-dimethylbenzonitrile has a molecular weight of 418.48 g/mol, XLogP of 4.05, 5 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[2-(3-fluoro-4-piperazin-1-ylanilino)pyrimidin-4-yl]oxy-3,5-dimethylbenzonitrile is sourced from PubChem (CID 172852325), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).