C28H29N7O3S — CID 175181474
5-[[4-[4-[(E)-2-cyanoethenyl]-2,6-dimethylphenoxy]pyrimidin-2-yl]amino]-2-(4-ethylsulfonylpiperazin-1-yl)benzonitrile (PubChem CID 175181474) has the molecular formula C28H29N7O3S and a molecular weight of 543.65 g/mol. Its IUPAC name is 5-[[4-[4-[(E)-2-cyanoethenyl]-2,6-dimethylphenoxy]pyrimidin-2-yl]amino]-2-(4-ethylsulfonylpiperazin-1-yl)benzonitrile.
| Compound Name | 5-[[4-[4-[(E)-2-cyanoethenyl]-2,6-dimethylphenoxy]pyrimidin-2-yl]amino]-2-(4-ethylsulfonylpiperazin-1-yl)benzonitrile |
|---|---|
| PubChem CID | 175181474 |
| Molecular Formula | C28H29N7O3S |
| Molecular Weight | 543.65 g/mol |
| Exact Mass | 543.21 |
| IUPAC Name | 5-[[4-[4-[(E)-2-cyanoethenyl]-2,6-dimethylphenoxy]pyrimidin-2-yl]amino]-2-(4-ethylsulfonylpiperazin-1-yl)benzonitrile |
| SMILES | CCS(=O)(=O)N1CCN(c2ccc(Nc3nccc(Oc4c(C)cc(/C=C/C#N)cc4C)n3)cc2C#N)CC1 |
| InChI | InChI=1S/C28H29N7O3S/c1-4-39(36,37)35-14-12-34(13-15-35)25-8-7-24(18-23(25)19-30)32-28-31-11-9-26(33-28)38-27-20(2)16-22(6-5-10-29)17-21(27)3/h5-9,11,16-18H,4,12-15H2,1-3H3,(H,31,32,33)/b6-5+ |
| InChIKey | AEXSVAYCVPXHRU-AATRIKPKSA-N |
| XLogP | 4.51 |
| TPSA | 135.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.65 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|