C28H32N6O3S — CID 177371183
(E)-3-[3,5-dimethyl-4-[2-[4-(4-propan-2-ylsulfonylpiperazin-1-yl)anilino]pyrimidin-4-yl]oxyphenyl]prop-2-enenitrile (PubChem CID 177371183) has the molecular formula C28H32N6O3S and a molecular weight of 532.67 g/mol. Its IUPAC name is (E)-3-[3,5-dimethyl-4-[2-[4-(4-propan-2-ylsulfonylpiperazin-1-yl)anilino]pyrimidin-4-yl]oxyphenyl]prop-2-enenitrile.
| Compound Name | (E)-3-[3,5-dimethyl-4-[2-[4-(4-propan-2-ylsulfonylpiperazin-1-yl)anilino]pyrimidin-4-yl]oxyphenyl]prop-2-enenitrile |
|---|---|
| PubChem CID | 177371183 |
| Molecular Formula | C28H32N6O3S |
| Molecular Weight | 532.67 g/mol |
| Exact Mass | 532.23 |
| IUPAC Name | (E)-3-[3,5-dimethyl-4-[2-[4-(4-propan-2-ylsulfonylpiperazin-1-yl)anilino]pyrimidin-4-yl]oxyphenyl]prop-2-enenitrile |
| SMILES | Cc1cc(/C=C/C#N)cc(C)c1Oc1ccnc(Nc2ccc(N3CCN(S(=O)(=O)C(C)C)CC3)cc2)n1 |
| InChI | InChI=1S/C28H32N6O3S/c1-20(2)38(35,36)34-16-14-33(15-17-34)25-9-7-24(8-10-25)31-28-30-13-11-26(32-28)37-27-21(3)18-23(6-5-12-29)19-22(27)4/h5-11,13,18-20H,14-17H2,1-4H3,(H,30,31,32)/b6-5+ |
| InChIKey | OQLFZLBTPCDLCF-AATRIKPKSA-N |
| XLogP | 5.03 |
| TPSA | 111.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.67 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|