C27H33N5O2 — CID 163730802
(E)-N-butyl-3-[3,5-dimethyl-4-[2-[4-(methylamino)anilino]pyrimidin-4-yl]oxyphenyl]-N-methylprop-2-enamide (PubChem CID 163730802) has the molecular formula C27H33N5O2 and a molecular weight of 459.59 g/mol. Its IUPAC name is (E)-N-butyl-3-[3,5-dimethyl-4-[2-[4-(methylamino)anilino]pyrimidin-4-yl]oxyphenyl]-N-methylprop-2-enamide.
| Compound Name | (E)-N-butyl-3-[3,5-dimethyl-4-[2-[4-(methylamino)anilino]pyrimidin-4-yl]oxyphenyl]-N-methylprop-2-enamide |
|---|---|
| PubChem CID | 163730802 |
| Molecular Formula | C27H33N5O2 |
| Molecular Weight | 459.59 g/mol |
| Exact Mass | 459.26 |
| IUPAC Name | (E)-N-butyl-3-[3,5-dimethyl-4-[2-[4-(methylamino)anilino]pyrimidin-4-yl]oxyphenyl]-N-methylprop-2-enamide |
| SMILES | CCCCN(C)C(=O)/C=C/c1cc(C)c(Oc2ccnc(Nc3ccc(NC)cc3)n2)c(C)c1 |
| InChI | InChI=1S/C27H33N5O2/c1-6-7-16-32(5)25(33)13-8-21-17-19(2)26(20(3)18-21)34-24-14-15-29-27(31-24)30-23-11-9-22(28-4)10-12-23/h8-15,17-18,28H,6-7,16H2,1-5H3,(H,29,30,31)/b13-8+ |
| InChIKey | KZJGHZSEUPRSEA-MDWZMJQESA-N |
| XLogP | 5.94 |
| TPSA | 79.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.59 |
| LogP ≤ 5 | 5.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|