C28H31N7O4S — CID 166627055
4-[4-[(E)-2-cyanoethenyl]-2,6-dimethylphenoxy]-2-[4-[3-(sulfamoylamino)piperidin-1-yl]anilino]-5,7-dihydrofuro[3,4-d]pyrimidine (PubChem CID 166627055) has the molecular formula C28H31N7O4S and a molecular weight of 561.67 g/mol. Its IUPAC name is 4-[4-[(E)-2-cyanoethenyl]-2,6-dimethylphenoxy]-2-[4-[3-(sulfamoylamino)piperidin-1-yl]anilino]-5,7-dihydrofuro[3,4-d]pyrimidine.
| Compound Name | 4-[4-[(E)-2-cyanoethenyl]-2,6-dimethylphenoxy]-2-[4-[3-(sulfamoylamino)piperidin-1-yl]anilino]-5,7-dihydrofuro[3,4-d]pyrimidine |
|---|---|
| PubChem CID | 166627055 |
| Molecular Formula | C28H31N7O4S |
| Molecular Weight | 561.67 g/mol |
| Exact Mass | 561.22 |
| IUPAC Name | 4-[4-[(E)-2-cyanoethenyl]-2,6-dimethylphenoxy]-2-[4-[3-(sulfamoylamino)piperidin-1-yl]anilino]-5,7-dihydrofuro[3,4-d]pyrimidine |
| SMILES | Cc1cc(/C=C/C#N)cc(C)c1Oc1nc(Nc2ccc(N3CCCC(NS(N)(=O)=O)C3)cc2)nc2c1COC2 |
| InChI | InChI=1S/C28H31N7O4S/c1-18-13-20(5-3-11-29)14-19(2)26(18)39-27-24-16-38-17-25(24)32-28(33-27)31-21-7-9-23(10-8-21)35-12-4-6-22(15-35)34-40(30,36)37/h3,5,7-10,13-14,22,34H,4,6,12,15-17H2,1-2H3,(H2,30,36,37)(H,31,32,33)/b5-3+ |
| InChIKey | GHOXHELCXNTDLD-HWKANZROSA-N |
| XLogP | 3.96 |
| TPSA | 155.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.67 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|