C25H28FN7O3S — CID 175741945
4-[4-[[4-(4-cyano-2,6-dimethylphenoxy)pyrimidin-2-yl]amino]-2-fluorophenyl]-N,N-dimethylpiperazine-1-sulfonamide (PubChem CID 175741945) has the molecular formula C25H28FN7O3S and a molecular weight of 525.61 g/mol. Its IUPAC name is 4-[4-[[4-(4-cyano-2,6-dimethylphenoxy)pyrimidin-2-yl]amino]-2-fluorophenyl]-N,N-dimethylpiperazine-1-sulfonamide.
| Compound Name | 4-[4-[[4-(4-cyano-2,6-dimethylphenoxy)pyrimidin-2-yl]amino]-2-fluorophenyl]-N,N-dimethylpiperazine-1-sulfonamide |
|---|---|
| PubChem CID | 175741945 |
| Molecular Formula | C25H28FN7O3S |
| Molecular Weight | 525.61 g/mol |
| Exact Mass | 525.20 |
| IUPAC Name | 4-[4-[[4-(4-cyano-2,6-dimethylphenoxy)pyrimidin-2-yl]amino]-2-fluorophenyl]-N,N-dimethylpiperazine-1-sulfonamide |
| SMILES | Cc1cc(C#N)cc(C)c1Oc1ccnc(Nc2ccc(N3CCN(S(=O)(=O)N(C)C)CC3)c(F)c2)n1 |
| InChI | InChI=1S/C25H28FN7O3S/c1-17-13-19(16-27)14-18(2)24(17)36-23-7-8-28-25(30-23)29-20-5-6-22(21(26)15-20)32-9-11-33(12-10-32)37(34,35)31(3)4/h5-8,13-15H,9-12H2,1-4H3,(H,28,29,30) |
| InChIKey | FRRPNJSYFSOBFP-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 114.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.61 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|