C28H32N6O3S — CID 146000565
N-[1-[[4-[[4-[4-(1-cyanoethenyl)-2,6-dimethylphenoxy]pyrimidin-2-yl]amino]phenyl]methyl]piperidin-4-yl]methanesulfonamide (PubChem CID 146000565) has the molecular formula C28H32N6O3S and a molecular weight of 532.67 g/mol. Its IUPAC name is N-[1-[[4-[[4-[4-(1-cyanoethenyl)-2,6-dimethylphenoxy]pyrimidin-2-yl]amino]phenyl]methyl]piperidin-4-yl]methanesulfonamide.
| Compound Name | N-[1-[[4-[[4-[4-(1-cyanoethenyl)-2,6-dimethylphenoxy]pyrimidin-2-yl]amino]phenyl]methyl]piperidin-4-yl]methanesulfonamide |
|---|---|
| PubChem CID | 146000565 |
| Molecular Formula | C28H32N6O3S |
| Molecular Weight | 532.67 g/mol |
| Exact Mass | 532.23 |
| IUPAC Name | N-[1-[[4-[[4-[4-(1-cyanoethenyl)-2,6-dimethylphenoxy]pyrimidin-2-yl]amino]phenyl]methyl]piperidin-4-yl]methanesulfonamide |
| SMILES | C=C(C#N)c1cc(C)c(Oc2ccnc(Nc3ccc(CN4CCC(NS(C)(=O)=O)CC4)cc3)n2)c(C)c1 |
| InChI | InChI=1S/C28H32N6O3S/c1-19-15-23(21(3)17-29)16-20(2)27(19)37-26-9-12-30-28(32-26)31-24-7-5-22(6-8-24)18-34-13-10-25(11-14-34)33-38(4,35)36/h5-9,12,15-16,25,33H,3,10-11,13-14,18H2,1-2,4H3,(H,30,31,32) |
| InChIKey | DJDQKRQCPKPAIF-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 120.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.67 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|